C21H20FN3O — CID 170221387
4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-2-fluorophenol (PubChem CID 170221387) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-2-fluorophenol.
| Compound Name | 4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-2-fluorophenol |
|---|---|
| PubChem CID | 170221387 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-2-fluorophenol |
| SMILES | [H]/N=C(\C)c1c(N)ccc2nc(-c3ccc(O)c(F)c3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C21H20FN3O/c1-11(23)19-16(24)7-8-17-20(19)13-4-2-3-5-14(13)21(25-17)12-6-9-18(26)15(22)10-12/h6-10,23,26H,2-5,24H2,1H3/b23-11+ |
| InChIKey | UBANYISHBUULBS-FOKLQQMPSA-N |
| XLogP | 4.60 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|