About tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate
tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 170222020) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 170222020 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | C=C(C)CCN(CC)c1ncc(C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C15H24N2O2S/c1-7-17(9-8-11(2)3)14-16-10-12(20-14)13(18)19-15(4,5)6/h10H,2,7-9H2,1,3-6H3 |
| InChIKey | BDGRAWBUKZRGIV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate?
The IUPAC name of tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate (CID 170222020) is tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate is C=C(C)CCN(CC)c1ncc(C(=O)OC(C)(C)C)s1.
What is the InChIKey of tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate?
The InChIKey is BDGRAWBUKZRGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-7-17(9-8-11(2)3)14-16-10-12(20-14)13(18)19-15(4,5)6/h10H,2,7-9H2,1,3-6H3.
What are the key properties of tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate?
tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate has a molecular weight of 296.44 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[ethyl(3-methylbut-3-enyl)amino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 170222020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).