C21H28N2 — CID 170222028
5-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]pyrimidine (PubChem CID 170222028) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 5-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]pyrimidine.
| Compound Name | 5-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]pyrimidine |
|---|---|
| PubChem CID | 170222028 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 5-[(1E)-4-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]penta-1,4-dienyl]pyrimidine |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)C/C=C/c2cncnc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C21H28N2/c1-6-21(5)11-10-19(12-20(21)16(2)3)17(4)8-7-9-18-13-22-15-23-14-18/h6-7,9,13-15,19-20H,1-2,4,8,10-12H2,3,5H3/b9-7+/t19-,20+,21-/m1/s1 |
| InChIKey | KXBIZBKXSDVXQJ-JPIQFJKMSA-N |
| XLogP | 5.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|