About imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane
imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane (PubChem CID 170222230) has the molecular formula C13H13NOS2
and a molecular weight of 263.39 g/mol. Its IUPAC name is imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane |
| PubChem CID | 170222230 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane |
| SMILES | [H]N=S(=O)(c1ccccc1)c1ccccc1SC |
| InChI | InChI=1S/C13H13NOS2/c1-16-12-9-5-6-10-13(12)17(14,15)11-7-3-2-4-8-11/h2-10,14H,1H3 |
| InChIKey | BPVCPVGENGDZCR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane?
The IUPAC name of imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane (CID 170222230) is imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane?
The canonical SMILES for imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane is [H]N=S(=O)(c1ccccc1)c1ccccc1SC.
What is the InChIKey of imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane?
The InChIKey is BPVCPVGENGDZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NOS2/c1-16-12-9-5-6-10-13(12)17(14,15)11-7-3-2-4-8-11/h2-10,14H,1H3.
What are the key properties of imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane?
imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane has a molecular weight of 263.39 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imino-(2-methylsulfanylphenyl)-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 170222230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).