C20H25F6N5O4S — CID 170222371
N-[(Z)-[(Z)-4,4,4-trifluoro-3-methyl-2-[[(2S)-1-[3-oxo-3-[3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]pyrrolidin-1-yl]propoxy]propan-2-yl]amino]but-2-enylidene]amino]formamide (PubChem CID 170222371) has the molecular formula C20H25F6N5O4S and a molecular weight of 545.51 g/mol. Its IUPAC name is N-[(Z)-[(Z)-4,4,4-trifluoro-3-methyl-2-[[(2S)-1-[3-oxo-3-[3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]pyrrolidin-1-yl]propoxy]propan-2-yl]amino]but-2-enylidene]amino]formamide.
| Compound Name | N-[(Z)-[(Z)-4,4,4-trifluoro-3-methyl-2-[[(2S)-1-[3-oxo-3-[3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]pyrrolidin-1-yl]propoxy]propan-2-yl]amino]but-2-enylidene]amino]formamide |
|---|---|
| PubChem CID | 170222371 |
| Molecular Formula | C20H25F6N5O4S |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-[(Z)-[(Z)-4,4,4-trifluoro-3-methyl-2-[[(2S)-1-[3-oxo-3-[3-[[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]pyrrolidin-1-yl]propoxy]propan-2-yl]amino]but-2-enylidene]amino]formamide |
| SMILES | C/C(=C(\C=N/NC=O)N[C@@H](C)COCCC(=O)N1CCC(Oc2ncc(C(F)(F)F)s2)C1)C(F)(F)F |
| InChI | InChI=1S/C20H25F6N5O4S/c1-12(30-15(7-28-29-11-32)13(2)19(21,22)23)10-34-6-4-17(33)31-5-3-14(9-31)35-18-27-8-16(36-18)20(24,25)26/h7-8,11-12,14,30H,3-6,9-10H2,1-2H3,(H,29,32)/b15-13-,28-7-/t12-,14?/m0/s1 |
| InChIKey | QDOHVPKXAFPLEJ-BKLDFAIRSA-N |
| XLogP | 3.09 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|