C44H31N3O — CID 170223012
2-(2-dibenzofuran-1-ylphenyl)-4-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 170223012) has the molecular formula C44H31N3O and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-(2-dibenzofuran-1-ylphenyl)-4-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(2-dibenzofuran-1-ylphenyl)-4-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170223012 |
| Molecular Formula | C44H31N3O |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 2-(2-dibenzofuran-1-ylphenyl)-4-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | C/C=C\C=C/c1ccc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3ccccc3-c3cccc4oc5ccccc5c34)n2)cc1 |
| InChI | InChI=1S/C44H31N3O/c1-2-3-5-14-30-25-27-32(28-26-30)42-45-43(34-18-12-17-33(29-34)31-15-6-4-7-16-31)47-44(46-42)37-20-9-8-19-35(37)36-22-13-24-40-41(36)38-21-10-11-23-39(38)48-40/h2-29H,1H3/b3-2-,14-5- |
| InChIKey | JSHMCCIVTDRLMQ-LGIONDOOSA-N |
| XLogP | 11.70 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|