C21H20FN3 — CID 170223225
9-(3-amino-4-fluorophenyl)-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-3-amine (PubChem CID 170223225) has the molecular formula C21H20FN3 and a molecular weight of 333.41 g/mol. Its IUPAC name is 9-(3-amino-4-fluorophenyl)-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-3-amine.
| Compound Name | 9-(3-amino-4-fluorophenyl)-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-3-amine |
|---|---|
| PubChem CID | 170223225 |
| Molecular Formula | C21H20FN3 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 9-(3-amino-4-fluorophenyl)-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-3-amine |
| SMILES | [H]/N=C/c1c(N)ccc2cc(-c3ccc(F)c(N)c3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C21H20FN3/c22-18-7-5-12(10-20(18)25)16-9-13-6-8-19(24)17(11-23)21(13)15-4-2-1-3-14(15)16/h5-11,23H,1-4,24-25H2/b23-11+ |
| InChIKey | CVRWXCPZGANQOJ-FOKLQQMPSA-N |
| XLogP | 4.69 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|