About (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene
(5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene (PubChem CID 170223486) has the molecular formula C14H17Br
and a molecular weight of 265.19 g/mol. Its IUPAC name is (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene |
| PubChem CID | 170223486 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=c1cccc/c1=C(\Br)C(C)C/C=C\C |
| InChI | InChI=1S/C14H17Br/c1-4-5-8-12(3)14(15)13-10-7-6-9-11(13)2/h4-7,9-10,12H,2,8H2,1,3H3/b5-4-,14-13+ |
| InChIKey | AESUAWLSAMVTET-SXEKXAKBSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene?
The IUPAC name of (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene (CID 170223486) is (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene.
What is the SMILES notation for (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene?
The canonical SMILES for (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene is C=c1cccc/c1=C(\Br)C(C)C/C=C\C.
What is the InChIKey of (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene?
The InChIKey is AESUAWLSAMVTET-SXEKXAKBSA-N. The full InChI is InChI=1S/C14H17Br/c1-4-5-8-12(3)14(15)13-10-7-6-9-11(13)2/h4-7,9-10,12H,2,8H2,1,3H3/b5-4-,14-13+.
What are the key properties of (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene?
(5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene has a molecular weight of 265.19 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(Z)-1-bromo-2-methylhex-4-enylidene]-6-methylidenecyclohexa-1,3-diene is sourced from PubChem (CID 170223486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).