C19H15N3O6 — CID 170224623
4-hydroxy-7-[2-oxo-6-(2-oxoethyl)-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]-1,3-benzodioxole-5-carbaldehyde (PubChem CID 170224623) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 4-hydroxy-7-[2-oxo-6-(2-oxoethyl)-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 4-hydroxy-7-[2-oxo-6-(2-oxoethyl)-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 170224623 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-hydroxy-7-[2-oxo-6-(2-oxoethyl)-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=CCn1cc(-c2cc(C=O)c(O)c3c2OCO3)c2c(=O)n3c(nc21)CCC3 |
| InChI | InChI=1S/C19H15N3O6/c23-5-4-21-7-12(14-18(21)20-13-2-1-3-22(13)19(14)26)11-6-10(8-24)15(25)17-16(11)27-9-28-17/h5-8,25H,1-4,9H2 |
| InChIKey | PNOPICQOMWTYEH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|