C57H110O6S4 — CID 170224668
2,3-bis(10-sulfanyloctadecanoyloxy)propyl 9,13-bis(sulfanyl)octadecanoate (PubChem CID 170224668) has the molecular formula C57H110O6S4 and a molecular weight of 1019.77 g/mol. Its IUPAC name is 2,3-bis(10-sulfanyloctadecanoyloxy)propyl 9,13-bis(sulfanyl)octadecanoate.
| Compound Name | 2,3-bis(10-sulfanyloctadecanoyloxy)propyl 9,13-bis(sulfanyl)octadecanoate |
|---|---|
| PubChem CID | 170224668 |
| Molecular Formula | C57H110O6S4 |
| Molecular Weight | 1019.77 g/mol |
| Exact Mass | 1018.72 |
| IUPAC Name | 2,3-bis(10-sulfanyloctadecanoyloxy)propyl 9,13-bis(sulfanyl)octadecanoate |
| SMILES | CCCCCCCCC(S)CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC(S)CCCC(S)CCCCC)OC(=O)CCCCCCCCC(S)CCCCCCCC |
| InChI | InChI=1S/C57H110O6S4/c1-4-7-10-12-19-28-38-51(64)40-30-21-14-16-24-33-45-55(58)61-48-50(63-57(60)47-35-25-17-15-22-31-41-52(65)39-29-20-13-11-8-5-2)49-62-56(59)46-34-26-18-23-32-42-54(67)44-36-43-53(66)37-27-9-6-3/h50-54,64-67H,4-49H2,1-3H3 |
| InChIKey | ZTALWFBEMMLASJ-UHFFFAOYSA-N |
| XLogP | 18.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.77 |
| LogP ≤ 5 | 18.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|