C25H19F2N3O4S — CID 170225020
N-[4-[3-(dihydroxymethyl)-6,7-difluoro-9H-pyrido[3,4-b]indol-1-yl]phenyl]-N-methylbenzenesulfonamide (PubChem CID 170225020) has the molecular formula C25H19F2N3O4S and a molecular weight of 495.51 g/mol. Its IUPAC name is N-[4-[3-(dihydroxymethyl)-6,7-difluoro-9H-pyrido[3,4-b]indol-1-yl]phenyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[4-[3-(dihydroxymethyl)-6,7-difluoro-9H-pyrido[3,4-b]indol-1-yl]phenyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 170225020 |
| Molecular Formula | C25H19F2N3O4S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[4-[3-(dihydroxymethyl)-6,7-difluoro-9H-pyrido[3,4-b]indol-1-yl]phenyl]-N-methylbenzenesulfonamide |
| SMILES | CN(c1ccc(-c2nc(C(O)O)cc3c2[nH]c2cc(F)c(F)cc23)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H19F2N3O4S/c1-30(35(33,34)16-5-3-2-4-6-16)15-9-7-14(8-10-15)23-24-18(12-22(29-23)25(31)32)17-11-19(26)20(27)13-21(17)28-24/h2-13,25,28,31-32H,1H3 |
| InChIKey | VHUPASRIGFMCKL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|