C12H10F5IO4S — CID 170225284
1,1,3,3,3-pentafluoro-2-(3-iodo-5-prop-1-en-2-ylphenoxy)propane-1-sulfonic acid (PubChem CID 170225284) has the molecular formula C12H10F5IO4S and a molecular weight of 472.17 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(3-iodo-5-prop-1-en-2-ylphenoxy)propane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(3-iodo-5-prop-1-en-2-ylphenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 170225284 |
| Molecular Formula | C12H10F5IO4S |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 471.93 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(3-iodo-5-prop-1-en-2-ylphenoxy)propane-1-sulfonic acid |
| SMILES | C=C(C)c1cc(I)cc(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C12H10F5IO4S/c1-6(2)7-3-8(18)5-9(4-7)22-10(11(13,14)15)12(16,17)23(19,20)21/h3-5,10H,1H2,2H3,(H,19,20,21) |
| InChIKey | CIEIONGFMHWRIG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|