C10H17N — CID 170225424
(2Z,4E)-N,3,5-trimethylhepta-2,4-dien-1-imine (PubChem CID 170225424) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4E)-N,3,5-trimethylhepta-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-N,3,5-trimethylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 170225424 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4E)-N,3,5-trimethylhepta-2,4-dien-1-imine |
| SMILES | CC/C(C)=C/C(C)=C\C=N\C |
| InChI | InChI=1S/C10H17N/c1-5-9(2)8-10(3)6-7-11-4/h6-8H,5H2,1-4H3/b9-8+,10-6-,11-7+ |
| InChIKey | SZZRHCFZLNSLHA-MFPWRDKGSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|