C52H55N — CID 170225803
N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-5-methylhepta-2,4-dien-2-yl]phenyl]cyclohexa-1,3-dien-1-yl]-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]aniline (PubChem CID 170225803) has the molecular formula C52H55N and a molecular weight of 694.02 g/mol. Its IUPAC name is N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-5-methylhepta-2,4-dien-2-yl]phenyl]cyclohexa-1,3-dien-1-yl]-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]aniline.
| Compound Name | N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-5-methylhepta-2,4-dien-2-yl]phenyl]cyclohexa-1,3-dien-1-yl]-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]aniline |
|---|---|
| PubChem CID | 170225803 |
| Molecular Formula | C52H55N |
| Molecular Weight | 694.02 g/mol |
| Exact Mass | 693.43 |
| IUPAC Name | N-[4-[4-[(2E,4Z)-6-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenyl]-5-methylhepta-2,4-dien-2-yl]phenyl]cyclohexa-1,3-dien-1-yl]-N-[(3Z,5E)-5-phenylhepta-1,3,5-trien-2-yl]aniline |
| SMILES | C=C(/C=C\C(=C/C)c1ccccc1)N(C1=CC=C(c2ccc(/C(C)=C/C=C(/C)C(C)c3ccc(C(/C=C\CC)=C/C)cc3)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C52H55N/c1-8-11-18-43(9-2)48-33-29-46(30-34-48)42(7)39(4)23-24-40(5)45-27-31-49(32-28-45)50-35-37-52(38-36-50)53(51-21-16-13-17-22-51)41(6)25-26-44(10-3)47-19-14-12-15-20-47/h9-35,37,42H,6,8,36,38H2,1-5,7H3/b18-11-,26-25-,39-23-,40-24+,43-9+,44-10+ |
| InChIKey | YLUOTRNYIAAKRO-FGQHTPAQSA-N |
| XLogP | 14.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.02 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|