About 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate
3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate (PubChem CID 170226338) has the molecular formula C11H22N4S2
and a molecular weight of 274.46 g/mol. Its IUPAC name is 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate.
Molecular Properties
| Compound Name | 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate |
| PubChem CID | 170226338 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCC1CC(CCS/C(N)=N/[H])C1 |
| InChI | InChI=1S/C11H22N4S2/c12-10(13)16-4-1-2-8-6-9(7-8)3-5-17-11(14)15/h8-9H,1-7H2,(H3,12,13)(H3,14,15) |
| InChIKey | RXDYKGJEKOCIMM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate?
The IUPAC name of 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate (CID 170226338) is 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate.
What is the SMILES notation for 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate?
The canonical SMILES for 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate is [H]/N=C(\N)SCCCC1CC(CCS/C(N)=N/[H])C1.
What is the InChIKey of 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate?
The InChIKey is RXDYKGJEKOCIMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4S2/c12-10(13)16-4-1-2-8-6-9(7-8)3-5-17-11(14)15/h8-9H,1-7H2,(H3,12,13)(H3,14,15).
What are the key properties of 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate?
3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate has a molecular weight of 274.46 g/mol, XLogP of 2.44, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-carbamimidoylsulfanylethyl)cyclobutyl]propyl carbamimidothioate is sourced from PubChem (CID 170226338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).