C25H33N3O5 — CID 170226436
tert-butyl 3-[6-[2-(methoxymethoxy)-4,6-dimethylphenyl]pyridazine-3-carbonyl]piperidine-1-carboxylate (PubChem CID 170226436) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl 3-[6-[2-(methoxymethoxy)-4,6-dimethylphenyl]pyridazine-3-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4,6-dimethylphenyl]pyridazine-3-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170226436 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4,6-dimethylphenyl]pyridazine-3-carbonyl]piperidine-1-carboxylate |
| SMILES | COCOc1cc(C)cc(C)c1-c1ccc(C(=O)C2CCCN(C(=O)OC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C25H33N3O5/c1-16-12-17(2)22(21(13-16)32-15-31-6)19-9-10-20(27-26-19)23(29)18-8-7-11-28(14-18)24(30)33-25(3,4)5/h9-10,12-13,18H,7-8,11,14-15H2,1-6H3 |
| InChIKey | XEAPHYWBLPQSHG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|