C19H26N4O6 — CID 170228106
7-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxycarbonyloxy]heptanoic acid (PubChem CID 170228106) has the molecular formula C19H26N4O6 and a molecular weight of 406.40 g/mol. Its IUPAC name is 7-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxycarbonyloxy]heptanoic acid.
| Compound Name | 7-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxycarbonyloxy]heptanoic acid |
|---|---|
| PubChem CID | 170228106 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 7-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxycarbonyloxy]heptanoic acid |
| SMILES | C1C[C@@H](O[C@@H]1COC(=O)OCCCCCCC(=O)O)C2=CC=C3N2N=CN=C3N |
| InChI | InChI=1S/C19H26N4O6/c20-18-15-8-7-14(23(15)22-12-21-18)16-9-6-13(29-16)11-28-19(26)27-10-4-2-1-3-5-17(24)25/h7-8,12-13,16H,1-6,9-11H2,(H,24,25)(H2,20,21,22)/t13-,16+/m0/s1 |
| InChIKey | APRAONSVLDDXRF-XJKSGUPXSA-N |
| XLogP | 1.70 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | 551 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|