About 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol
3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol (PubChem CID 170229104) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol.
Molecular Properties
| Compound Name | 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol |
| PubChem CID | 170229104 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol |
| SMILES | NCCC(O)C1=CC=CCC=C1 |
| InChI | InChI=1S/C10H15NO/c11-8-7-10(12)9-5-3-1-2-4-6-9/h1,3-6,10,12H,2,7-8,11H2 |
| InChIKey | BNXZBYKAWMOJIU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol?
The IUPAC name of 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol (CID 170229104) is 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol.
What is the SMILES notation for 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol?
The canonical SMILES for 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol is NCCC(O)C1=CC=CCC=C1.
What is the InChIKey of 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol?
The InChIKey is BNXZBYKAWMOJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c11-8-7-10(12)9-5-3-1-2-4-6-9/h1,3-6,10,12H,2,7-8,11H2.
What are the key properties of 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol?
3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol has a molecular weight of 165.24 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-cyclohepta-1,3,6-trien-1-ylpropan-1-ol is sourced from PubChem (CID 170229104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).