C27H36O4 — CID 170229124
2-[(4-hydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-4,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 170229124) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[(4-hydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-4,5-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | 2-[(4-hydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 170229124 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-[(4-hydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC1=C(C)C(=O)OC(CC2CCC3C4CC=C5C(O)C=CC(=O)C5(C)C4CCC23C)C1 |
| InChI | InChI=1S/C27H36O4/c1-15-13-18(31-25(30)16(15)2)14-17-5-7-20-19-6-8-22-23(28)9-10-24(29)27(22,4)21(19)11-12-26(17,20)3/h8-10,17-21,23,28H,5-7,11-14H2,1-4H3 |
| InChIKey | SWMPPZAOHLTFDB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|