C16H18ClN5O2S — CID 17022917
N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-5-methylpyrazole-4-sulfonamide (PubChem CID 17022917) has the molecular formula C16H18ClN5O2S and a molecular weight of 379.87 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-5-methylpyrazole-4-sulfonamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 17022917 |
| Molecular Formula | C16H18ClN5O2S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-1-ethyl-5-methylpyrazole-4-sulfonamide |
| SMILES | CCn1ncc(S(=O)(=O)Nc2ccn(Cc3ccc(Cl)cc3)n2)c1C |
| InChI | InChI=1S/C16H18ClN5O2S/c1-3-22-12(2)15(10-18-22)25(23,24)20-16-8-9-21(19-16)11-13-4-6-14(17)7-5-13/h4-10H,3,11H2,1-2H3,(H,19,20) |
| InChIKey | AVMUDHLCGQPGGH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |