C20H29N3 — CID 170229348
N'-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]-N-[(2Z,4E)-6-methyl-1-(methylideneamino)octa-2,4,7-trien-4-yl]ethanimidamide (PubChem CID 170229348) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is N'-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]-N-[(2Z,4E)-6-methyl-1-(methylideneamino)octa-2,4,7-trien-4-yl]ethanimidamide.
| Compound Name | N'-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]-N-[(2Z,4E)-6-methyl-1-(methylideneamino)octa-2,4,7-trien-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 170229348 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | N'-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]-N-[(2Z,4E)-6-methyl-1-(methylideneamino)octa-2,4,7-trien-4-yl]ethanimidamide |
| SMILES | C=CC(/N=C(\C)NC(/C=C\CN=C)=C/C(C)C=C)=C(C)\C=C/C |
| InChI | InChI=1S/C20H29N3/c1-8-12-17(5)20(10-3)23-18(6)22-19(13-11-14-21-7)15-16(4)9-2/h8-13,15-16H,2-3,7,14H2,1,4-6H3,(H,22,23)/b12-8-,13-11-,19-15+,20-17+ |
| InChIKey | BAKNJUXSNVLTLQ-ZRCKHNCISA-N |
| XLogP | 4.99 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|