C23H21N6OP — CID 170229365
4-[methyl(pyridin-4-yl)amino]-N-[6-[phosphanyl(pyridin-4-yl)amino]-2-pyridinyl]benzamide (PubChem CID 170229365) has the molecular formula C23H21N6OP and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-[methyl(pyridin-4-yl)amino]-N-[6-[phosphanyl(pyridin-4-yl)amino]-2-pyridinyl]benzamide.
| Compound Name | 4-[methyl(pyridin-4-yl)amino]-N-[6-[phosphanyl(pyridin-4-yl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 170229365 |
| Molecular Formula | C23H21N6OP |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[methyl(pyridin-4-yl)amino]-N-[6-[phosphanyl(pyridin-4-yl)amino]-2-pyridinyl]benzamide |
| SMILES | CN(c1ccncc1)c1ccc(C(=O)Nc2cccc(N(P)c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C23H21N6OP/c1-28(19-9-13-24-14-10-19)18-7-5-17(6-8-18)23(30)27-21-3-2-4-22(26-21)29(31)20-11-15-25-16-12-20/h2-16H,31H2,1H3,(H,26,27,30) |
| InChIKey | GSBBFNCVZVXFGZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|