About 7-fluoro-2,3-dihydronaphthalen-2-amine
7-fluoro-2,3-dihydronaphthalen-2-amine (PubChem CID 170229740) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 7-fluoro-2,3-dihydronaphthalen-2-amine.
Molecular Properties
| Compound Name | 7-fluoro-2,3-dihydronaphthalen-2-amine |
| PubChem CID | 170229740 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 7-fluoro-2,3-dihydronaphthalen-2-amine |
| SMILES | NC1C=c2cc(F)ccc2=CC1 |
| InChI | InChI=1S/C10H10FN/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-3,5-6,10H,4,12H2 |
| InChIKey | PPBMCNMDRWPLMR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-2,3-dihydronaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,3-dihydronaphthalen-2-amine?
The IUPAC name of 7-fluoro-2,3-dihydronaphthalen-2-amine (CID 170229740) is 7-fluoro-2,3-dihydronaphthalen-2-amine.
What is the SMILES notation for 7-fluoro-2,3-dihydronaphthalen-2-amine?
The canonical SMILES for 7-fluoro-2,3-dihydronaphthalen-2-amine is NC1C=c2cc(F)ccc2=CC1.
What is the InChIKey of 7-fluoro-2,3-dihydronaphthalen-2-amine?
The InChIKey is PPBMCNMDRWPLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-3,5-6,10H,4,12H2.
What are the key properties of 7-fluoro-2,3-dihydronaphthalen-2-amine?
7-fluoro-2,3-dihydronaphthalen-2-amine has a molecular weight of 163.19 g/mol, XLogP of 0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dihydronaphthalen-2-amine is sourced from PubChem (CID 170229740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).