C37H37N — CID 170229984
9-(2,2-dimethylpropyl)-15,16,18-trimethyl-13-methylidene-11-[(Z)-1-phenylprop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 170229984) has the molecular formula C37H37N and a molecular weight of 495.71 g/mol. Its IUPAC name is 9-(2,2-dimethylpropyl)-15,16,18-trimethyl-13-methylidene-11-[(Z)-1-phenylprop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 9-(2,2-dimethylpropyl)-15,16,18-trimethyl-13-methylidene-11-[(Z)-1-phenylprop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170229984 |
| Molecular Formula | C37H37N |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 9-(2,2-dimethylpropyl)-15,16,18-trimethyl-13-methylidene-11-[(Z)-1-phenylprop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | C=c1c2c(C)c(C)cc(C)c2n2c3ccccc3c3c(CC(C)(C)C)cc(/C(=C\C)c4ccccc4)c1c32 |
| InChI | InChI=1S/C37H37N/c1-9-28(26-15-11-10-12-16-26)30-20-27(21-37(6,7)8)34-29-17-13-14-18-31(29)38-35-23(3)19-22(2)24(4)32(35)25(5)33(30)36(34)38/h9-20H,5,21H2,1-4,6-8H3/b28-9- |
| InChIKey | ACOYBKCBBKYUQG-BMWVXGTQSA-N |
| XLogP | 9.49 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|