C28H24F3N — CID 170229993
3,15,16,18-tetramethyl-13-methylidene-11-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 170229993) has the molecular formula C28H24F3N and a molecular weight of 431.50 g/mol. Its IUPAC name is 3,15,16,18-tetramethyl-13-methylidene-11-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 3,15,16,18-tetramethyl-13-methylidene-11-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170229993 |
| Molecular Formula | C28H24F3N |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3,15,16,18-tetramethyl-13-methylidene-11-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | C=c1c2c(C)c(C)cc(C)c2n2c3c(C)cccc3c3ccc(/C(=C\C)C(F)(F)F)c1c32 |
| InChI | InChI=1S/C28H24F3N/c1-7-22(28(29,30)31)21-12-11-20-19-10-8-9-14(2)25(19)32-26-16(4)13-15(3)17(5)23(26)18(6)24(21)27(20)32/h7-13H,6H2,1-5H3/b22-7+ |
| InChIKey | ZUMPSFNEXUCIGR-QPJQQBGISA-N |
| XLogP | 7.73 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|