About cadmium(2+);bis(2-ethylhexanoate)
cadmium(2+);bis(2-ethylhexanoate) (PubChem CID 17023) has the molecular formula C16H30CdO4
and a molecular weight of 398.82 g/mol. Its IUPAC name is cadmium(2+);bis(2-ethylhexanoate).
Molecular Properties
| Compound Name | cadmium(2+);bis(2-ethylhexanoate) |
| PubChem CID | 17023 |
| Molecular Formula | C16H30CdO4 |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | cadmium(2+);bis(2-ethylhexanoate) |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C8H16O2.Cd/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | RXROCZREIWVERD-UHFFFAOYSA-L |
| XLogP | 1.90 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium(2+);bis(2-ethylhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(2-ethylhexanoate)?
The IUPAC name of cadmium(2+);bis(2-ethylhexanoate) (CID 17023) is cadmium(2+);bis(2-ethylhexanoate).
What is the SMILES notation for cadmium(2+);bis(2-ethylhexanoate)?
The canonical SMILES for cadmium(2+);bis(2-ethylhexanoate) is CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(2-ethylhexanoate)?
The InChIKey is RXROCZREIWVERD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H16O2.Cd/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(2-ethylhexanoate)?
cadmium(2+);bis(2-ethylhexanoate) has a molecular weight of 398.82 g/mol, XLogP of 1.90, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(2-ethylhexanoate) is sourced from PubChem (CID 17023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).