About dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate
dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate (PubChem CID 170230330) has the molecular formula C17H21BrF3NO4
and a molecular weight of 440.26 g/mol. Its IUPAC name is dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate.
Molecular Properties
| Compound Name | dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate |
| PubChem CID | 170230330 |
| Molecular Formula | C17H21BrF3NO4 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate |
| SMILES | CCCOC(=O)C(C(=O)OCCC)N(CC(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C17H21BrF3NO4/c1-3-9-25-15(23)14(16(24)26-10-4-2)22(11-17(19,20)21)13-8-6-5-7-12(13)18/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | AYMZKCYJSJHQFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate?
The IUPAC name of dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate (CID 170230330) is dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate.
What is the SMILES notation for dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate?
The canonical SMILES for dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate is CCCOC(=O)C(C(=O)OCCC)N(CC(F)(F)F)c1ccccc1Br.
What is the InChIKey of dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate?
The InChIKey is AYMZKCYJSJHQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrF3NO4/c1-3-9-25-15(23)14(16(24)26-10-4-2)22(11-17(19,20)21)13-8-6-5-7-12(13)18/h5-8,14H,3-4,9-11H2,1-2H3.
What are the key properties of dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate?
dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate has a molecular weight of 440.26 g/mol, XLogP of 4.09, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl 2-[2-bromo-N-(2,2,2-trifluoroethyl)anilino]propanedioate is sourced from PubChem (CID 170230330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).