C17H23N5O2S — CID 170230590
2,2-dimethyl-N'-[(Z)-3-[3-(5-methyl-3-sulfanylcyclohexa-1,5-dien-1-yl)-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide (PubChem CID 170230590) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[(Z)-3-[3-(5-methyl-3-sulfanylcyclohexa-1,5-dien-1-yl)-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide.
| Compound Name | 2,2-dimethyl-N'-[(Z)-3-[3-(5-methyl-3-sulfanylcyclohexa-1,5-dien-1-yl)-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 170230590 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2,2-dimethyl-N'-[(Z)-3-[3-(5-methyl-3-sulfanylcyclohexa-1,5-dien-1-yl)-1,2,4-triazol-1-yl]prop-2-enoyl]propanehydrazide |
| SMILES | CC1=CC(c2ncn(/C=C\C(=O)NNC(=O)C(C)(C)C)n2)=CC(S)C1 |
| InChI | InChI=1S/C17H23N5O2S/c1-11-7-12(9-13(25)8-11)15-18-10-22(21-15)6-5-14(23)19-20-16(24)17(2,3)4/h5-7,9-10,13,25H,8H2,1-4H3,(H,19,23)(H,20,24)/b6-5- |
| InChIKey | IMORWWOLJAHTPK-WAYWQWQTSA-N |
| XLogP | 1.97 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|