C19H25NO7 — CID 170230873
3-O-methyl 2-O,2-O'-dipropyl 1-(4-methoxyphenyl)aziridine-2,2,3-tricarboxylate (PubChem CID 170230873) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-O-methyl 2-O,2-O'-dipropyl 1-(4-methoxyphenyl)aziridine-2,2,3-tricarboxylate.
| Compound Name | 3-O-methyl 2-O,2-O'-dipropyl 1-(4-methoxyphenyl)aziridine-2,2,3-tricarboxylate |
|---|---|
| PubChem CID | 170230873 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-O-methyl 2-O,2-O'-dipropyl 1-(4-methoxyphenyl)aziridine-2,2,3-tricarboxylate |
| SMILES | CCCOC(=O)C1(C(=O)OCCC)C(C(=O)OC)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25NO7/c1-5-11-26-17(22)19(18(23)27-12-6-2)15(16(21)25-4)20(19)13-7-9-14(24-3)10-8-13/h7-10,15H,5-6,11-12H2,1-4H3 |
| InChIKey | VIBGCBRIWUMRGW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|