C31H29N3 — CID 170231105
3-(3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl)-2,2-dimethylpropanenitrile (PubChem CID 170231105) has the molecular formula C31H29N3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-(3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl)-2,2-dimethylpropanenitrile.
| Compound Name | 3-(3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 170231105 |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3-(3-tert-butyl-5-methyl-1,9-diazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2(7),3,5,8,10,12,14,16,18,20,22-undecaen-14-yl)-2,2-dimethylpropanenitrile |
| SMILES | Cc1cc(C(C)(C)C)c2c(c1)c1nccc3cc(CC(C)(C)C#N)c4c5ccccc5n2c4c31 |
| InChI | InChI=1S/C31H29N3/c1-18-13-22-27-26-19(11-12-33-27)15-20(16-31(5,6)17-32)25-21-9-7-8-10-24(21)34(29(25)26)28(22)23(14-18)30(2,3)4/h7-15H,16H2,1-6H3 |
| InChIKey | QEPOYXZEEPLVMQ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|