C37H39N — CID 170231222
9-(1-adamantyl)-6,15,16,18-tetramethyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene (PubChem CID 170231222) has the molecular formula C37H39N and a molecular weight of 497.73 g/mol. Its IUPAC name is 9-(1-adamantyl)-6,15,16,18-tetramethyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene.
| Compound Name | 9-(1-adamantyl)-6,15,16,18-tetramethyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene |
|---|---|
| PubChem CID | 170231222 |
| Molecular Formula | C37H39N |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 9-(1-adamantyl)-6,15,16,18-tetramethyl-13-methylidene-11-[(Z)-prop-1-enyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaene |
| SMILES | C=c1c2c(C)c(C)cc(C)c2n2c3cccc(C)c3c3c(C45CC6CC(CC(C6)C4)C5)cc(/C=C\C)c1c32 |
| InChI | InChI=1S/C37H39N/c1-7-9-28-16-29(37-17-25-13-26(18-37)15-27(14-25)19-37)34-31-20(2)10-8-11-30(31)38-35-22(4)12-21(3)23(5)32(35)24(6)33(28)36(34)38/h7-12,16,25-27H,6,13-15,17-19H2,1-5H3/b9-7- |
| InChIKey | CLPOBNKOGKBYDN-CLFYSBASSA-N |
| XLogP | 9.26 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|