C33H26ClF2N3O6 — CID 170231532
[(1S,2R)-2-hydroxy-1,2-diphenylethyl] 4-[3-chloro-4-[(3,5-difluoro-2-pyridinyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-5-methylpyridine-2-carboperoxoate (PubChem CID 170231532) has the molecular formula C33H26ClF2N3O6 and a molecular weight of 634.04 g/mol. Its IUPAC name is [(1S,2R)-2-hydroxy-1,2-diphenylethyl] 4-[3-chloro-4-[(3,5-difluoro-2-pyridinyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-5-methylpyridine-2-carboperoxoate.
| Compound Name | [(1S,2R)-2-hydroxy-1,2-diphenylethyl] 4-[3-chloro-4-[(3,5-difluoro-2-pyridinyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-5-methylpyridine-2-carboperoxoate |
|---|---|
| PubChem CID | 170231532 |
| Molecular Formula | C33H26ClF2N3O6 |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | [(1S,2R)-2-hydroxy-1,2-diphenylethyl] 4-[3-chloro-4-[(3,5-difluoro-2-pyridinyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-5-methylpyridine-2-carboperoxoate |
| SMILES | Cc1cnc(C(=O)OO[C@@H](c2ccccc2)[C@H](O)c2ccccc2)cc1-n1c(C)cc(OCc2ncc(F)cc2F)c(Cl)c1=O |
| InChI | InChI=1S/C33H26ClF2N3O6/c1-19-16-37-25(33(42)45-44-31(22-11-7-4-8-12-22)30(40)21-9-5-3-6-10-21)15-27(19)39-20(2)13-28(29(34)32(39)41)43-18-26-24(36)14-23(35)17-38-26/h3-17,30-31,40H,18H2,1-2H3/t30-,31+/m1/s1 |
| InChIKey | RWOJWPOIZJZUOQ-JSOSNVBQSA-N |
| XLogP | 6.32 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|