C29H35F2N6O8P — CID 170231833
(1-ethyl-3,3-difluoropiperidin-4-yl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170231833) has the molecular formula C29H35F2N6O8P and a molecular weight of 664.60 g/mol. Its IUPAC name is (1-ethyl-3,3-difluoropiperidin-4-yl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (1-ethyl-3,3-difluoropiperidin-4-yl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170231833 |
| Molecular Formula | C29H35F2N6O8P |
| Molecular Weight | 664.60 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | (1-ethyl-3,3-difluoropiperidin-4-yl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCN1CCC(OC(=O)[C@H](C)NP(=O)(OC[C@@]2(C#N)O[C@@H](c3ccc4c(N)ccnn34)[C@H](O)[C@@H]2O)Oc2ccccc2)C(F)(F)C1 |
| InChI | InChI=1S/C29H35F2N6O8P/c1-3-36-14-12-23(29(30,31)16-36)43-27(40)18(2)35-46(41,45-19-7-5-4-6-8-19)42-17-28(15-32)26(39)24(38)25(44-28)22-10-9-21-20(33)11-13-34-37(21)22/h4-11,13,18,23-26,38-39H,3,12,14,16-17,33H2,1-2H3,(H,35,41)/t18-,23?,24-,25-,26-,28+,46?/m0/s1 |
| InChIKey | CMQRIEFFSPSJCA-YWBYDKIASA-N |
| XLogP | 2.43 |
| TPSA | 193.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|