C15H17F3N2O2 — CID 170232008
3-[methyl-[(3E,5E)-5-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl]amino]piperidine-2,6-dione (PubChem CID 170232008) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 3-[methyl-[(3E,5E)-5-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[methyl-[(3E,5E)-5-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170232008 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[methyl-[(3E,5E)-5-(trifluoromethyl)octa-1,3,5,7-tetraen-3-yl]amino]piperidine-2,6-dione |
| SMILES | C=C/C=C(\C=C(/C=C)N(C)C1CCC(=O)NC1=O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O2/c1-4-6-10(15(16,17)18)9-11(5-2)20(3)12-7-8-13(21)19-14(12)22/h4-6,9,12H,1-2,7-8H2,3H3,(H,19,21,22)/b10-6+,11-9+ |
| InChIKey | YAGUWDRNIHMGEB-BBYAVRKXSA-N |
| XLogP | 2.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|