C17H33N3O5 — CID 170232279
2-(butylamino)-N-(2-methoxyethyl)-N-[2-[2-methoxyethyl(2-oxopropyl)amino]-2-oxoethyl]acetamide (PubChem CID 170232279) has the molecular formula C17H33N3O5 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(butylamino)-N-(2-methoxyethyl)-N-[2-[2-methoxyethyl(2-oxopropyl)amino]-2-oxoethyl]acetamide.
| Compound Name | 2-(butylamino)-N-(2-methoxyethyl)-N-[2-[2-methoxyethyl(2-oxopropyl)amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 170232279 |
| Molecular Formula | C17H33N3O5 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2-(butylamino)-N-(2-methoxyethyl)-N-[2-[2-methoxyethyl(2-oxopropyl)amino]-2-oxoethyl]acetamide |
| SMILES | CCCCNCC(=O)N(CCOC)CC(=O)N(CCOC)CC(C)=O |
| InChI | InChI=1S/C17H33N3O5/c1-5-6-7-18-12-16(22)20(9-11-25-4)14-17(23)19(8-10-24-3)13-15(2)21/h18H,5-14H2,1-4H3 |
| InChIKey | QNMVWEJSLWYQDY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|