C21H17N7O2 — CID 17023252
2-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 17023252) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 2-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 17023252 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | Cc1nn(Cc2cccc(-c3nc4c5ccccc5ncn4n3)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N7O2/c1-13-19(28(29)30)14(2)26(24-13)11-15-6-5-7-16(10-15)20-23-21-17-8-3-4-9-18(17)22-12-27(21)25-20/h3-10,12H,11H2,1-2H3 |
| InChIKey | WPXDABUDUWNQBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|