C8H10IN3O — CID 170232622
N-iodo-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 170232622) has the molecular formula C8H10IN3O and a molecular weight of 291.09 g/mol. Its IUPAC name is N-iodo-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-iodo-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 170232622 |
| Molecular Formula | C8H10IN3O |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | N-iodo-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NI)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C8H10IN3O/c9-10-8(13)7-5-3-1-2-4-6(5)11-12-7/h1-4H2,(H,10,13)(H,11,12) |
| InChIKey | YPRZHKNKBIMOHG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|