About 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane
3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane (PubChem CID 170232639) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane |
| PubChem CID | 170232639 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane |
| SMILES | C=C1NC2(CCCCC2)C(=C)N1C |
| InChI | InChI=1S/C11H18N2/c1-9-11(7-5-4-6-8-11)12-10(2)13(9)3/h12H,1-2,4-8H2,3H3 |
| InChIKey | DHKXIZLMQJUIBE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane?
The IUPAC name of 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane (CID 170232639) is 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane.
What is the SMILES notation for 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane?
The canonical SMILES for 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane is C=C1NC2(CCCCC2)C(=C)N1C.
What is the InChIKey of 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane?
The InChIKey is DHKXIZLMQJUIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-11(7-5-4-6-8-11)12-10(2)13(9)3/h12H,1-2,4-8H2,3H3.
What are the key properties of 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane?
3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane has a molecular weight of 178.28 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4-dimethylidene-1,3-diazaspiro[4.5]decane is sourced from PubChem (CID 170232639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).