About 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide
2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide (PubChem CID 170233465) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide |
| PubChem CID | 170233465 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide |
| SMILES | CC(C)NC(=O)C1=CCCC(=O)O1 |
| InChI | InChI=1S/C9H13NO3/c1-6(2)10-9(12)7-4-3-5-8(11)13-7/h4,6H,3,5H2,1-2H3,(H,10,12) |
| InChIKey | KJVSFPZUDFOZKB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide?
The IUPAC name of 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide (CID 170233465) is 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide.
What is the SMILES notation for 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide?
The canonical SMILES for 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide is CC(C)NC(=O)C1=CCCC(=O)O1.
What is the InChIKey of 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide?
The InChIKey is KJVSFPZUDFOZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-6(2)10-9(12)7-4-3-5-8(11)13-7/h4,6H,3,5H2,1-2H3,(H,10,12).
What are the key properties of 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide?
2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide has a molecular weight of 183.21 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-propan-2-yl-3,4-dihydropyran-6-carboxamide is sourced from PubChem (CID 170233465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).