About [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol
[4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol (PubChem CID 170234033) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol.
Molecular Properties
| Compound Name | [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol |
| PubChem CID | 170234033 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol |
| SMILES | C=C(CC1=CC=C(CS)C1)NC |
| InChI | InChI=1S/C10H15NS/c1-8(11-2)5-9-3-4-10(6-9)7-12/h3-4,11-12H,1,5-7H2,2H3 |
| InChIKey | WIYMUFYOKIIVAU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol?
The IUPAC name of [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol (CID 170234033) is [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol.
What is the SMILES notation for [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol?
The canonical SMILES for [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol is C=C(CC1=CC=C(CS)C1)NC.
What is the InChIKey of [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol?
The InChIKey is WIYMUFYOKIIVAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-8(11-2)5-9-3-4-10(6-9)7-12/h3-4,11-12H,1,5-7H2,2H3.
What are the key properties of [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol?
[4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol has a molecular weight of 181.30 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(methylamino)prop-2-enyl]cyclopenta-1,3-dien-1-yl]methanethiol is sourced from PubChem (CID 170234033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).