C29H28N6O2 — CID 170234569
N'-(1,3-diphenyl-4,5-dihydrodiazepine-7-carbonyl)-1-ethyl-2-methylbenzimidazole-5-carbohydrazide (PubChem CID 170234569) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N'-(1,3-diphenyl-4,5-dihydrodiazepine-7-carbonyl)-1-ethyl-2-methylbenzimidazole-5-carbohydrazide.
| Compound Name | N'-(1,3-diphenyl-4,5-dihydrodiazepine-7-carbonyl)-1-ethyl-2-methylbenzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 170234569 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N'-(1,3-diphenyl-4,5-dihydrodiazepine-7-carbonyl)-1-ethyl-2-methylbenzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)C3=CCCC(c4ccccc4)=NN3c3ccccc3)ccc21 |
| InChI | InChI=1S/C29H28N6O2/c1-3-34-20(2)30-25-19-22(17-18-26(25)34)28(36)31-32-29(37)27-16-10-15-24(21-11-6-4-7-12-21)33-35(27)23-13-8-5-9-14-23/h4-9,11-14,16-19H,3,10,15H2,1-2H3,(H,31,36)(H,32,37) |
| InChIKey | QOPAVVIXEXPWMK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|