C17H11F3I3NO7S — CID 170235710
[5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate (PubChem CID 170235710) has the molecular formula C17H11F3I3NO7S and a molecular weight of 811.05 g/mol. Its IUPAC name is [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate.
| Compound Name | [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 170235710 |
| Molecular Formula | C17H11F3I3NO7S |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.73 |
| IUPAC Name | [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate |
| SMILES | O=C(OC1C2CC3C(OC(=O)C31)C2C(=O)NS(=O)(=O)C(F)(F)F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C17H11F3I3NO7S/c18-17(19,20)32(28,29)24-14(25)9-5-3-6-10(16(27)31-12(6)9)13(5)30-15(26)7-1-4(21)2-8(22)11(7)23/h1-2,5-6,9-10,12-13H,3H2,(H,24,25) |
| InChIKey | KNFZZRFLSIGQNJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|