C16H9F3I3NO8S — CID 170235716
[5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate (PubChem CID 170235716) has the molecular formula C16H9F3I3NO8S and a molecular weight of 813.02 g/mol. Its IUPAC name is [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate.
| Compound Name | [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 170235716 |
| Molecular Formula | C16H9F3I3NO8S |
| Molecular Weight | 813.02 g/mol |
| Exact Mass | 812.71 |
| IUPAC Name | [5-oxo-2-(trifluoromethylsulfonylcarbamoyl)-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl] 2,3,5-triiodobenzoate |
| SMILES | O=C(OC1C2OC3C(OC(=O)C13)C2C(=O)NS(=O)(=O)C(F)(F)F)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H9F3I3NO8S/c17-16(18,19)32(27,28)23-13(24)6-9-12(7-11(29-9)10(6)31-15(7)26)30-14(25)4-1-3(20)2-5(21)8(4)22/h1-2,6-7,9-12H,(H,23,24) |
| InChIKey | URRNMHHLZPZXJI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.02 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|