C17H15N5O2 — CID 170235948
N-[2-(7-methoxy-1H-indazol-6-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]formamide (PubChem CID 170235948) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[2-(7-methoxy-1H-indazol-6-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]formamide.
| Compound Name | N-[2-(7-methoxy-1H-indazol-6-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]formamide |
|---|---|
| PubChem CID | 170235948 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-(7-methoxy-1H-indazol-6-yl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]formamide |
| SMILES | COc1c(-c2cc3cc(NC=O)ncc3n2C)ccc2cn[nH]c12 |
| InChI | InChI=1S/C17H15N5O2/c1-22-13(5-11-6-15(19-9-23)18-8-14(11)22)12-4-3-10-7-20-21-16(10)17(12)24-2/h3-9H,1-2H3,(H,20,21)(H,18,19,23) |
| InChIKey | AAZMFMPQXBHCAO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|