C18H18FN3O2 — CID 17023597
(3aR,7aS)-2-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 17023597) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is (3aR,7aS)-2-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 17023597 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (3aR,7aS)-2-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CCCC[C@H]2C(=O)N1c1cnn(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-5-3-4-12(8-13)10-21-11-14(9-20-21)22-17(23)15-6-1-2-7-16(15)18(22)24/h3-5,8-9,11,15-16H,1-2,6-7,10H2/t15-,16+ |
| InChIKey | YMYMVMQDCJLRGE-IYBDPMFKSA-N |
| XLogP | 2.75 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|