About 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene
5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene (PubChem CID 170237470) has the molecular formula C17H13I
and a molecular weight of 344.19 g/mol. Its IUPAC name is 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene.
Molecular Properties
| Compound Name | 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene |
| PubChem CID | 170237470 |
| Molecular Formula | C17H13I |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene |
| SMILES | Ic1cc2cc3c(cc2c2ccccc12)CCC3 |
| InChI | InChI=1S/C17H13I/c18-17-10-13-8-11-4-3-5-12(11)9-16(13)14-6-1-2-7-15(14)17/h1-2,6-10H,3-5H2 |
| InChIKey | AGNWYZNVEIHBPI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene?
The IUPAC name of 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene (CID 170237470) is 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene.
What is the SMILES notation for 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene?
The canonical SMILES for 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene is Ic1cc2cc3c(cc2c2ccccc12)CCC3.
What is the InChIKey of 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene?
The InChIKey is AGNWYZNVEIHBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13I/c18-17-10-13-8-11-4-3-5-12(11)9-16(13)14-6-1-2-7-15(14)17/h1-2,6-10H,3-5H2.
What are the key properties of 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene?
5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene has a molecular weight of 344.19 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-9,10-dihydro-8H-cyclopenta[b]phenanthrene is sourced from PubChem (CID 170237470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).