About 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide
5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide (PubChem CID 170237531) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide.
Molecular Properties
| Compound Name | 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide |
| PubChem CID | 170237531 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide |
| SMILES | CC/C=C\C1=C(C(=O)NC)C=NCC=C1C |
| InChI | InChI=1S/C13H18N2O/c1-4-5-6-11-10(2)7-8-15-9-12(11)13(16)14-3/h5-7,9H,4,8H2,1-3H3,(H,14,16)/b6-5- |
| InChIKey | OVAFAHMROOAVEN-WAYWQWQTSA-N |
| XLogP | 2.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide?
The IUPAC name of 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide (CID 170237531) is 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide?
The canonical SMILES for 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide is CC/C=C\C1=C(C(=O)NC)C=NCC=C1C.
What is the InChIKey of 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide?
The InChIKey is OVAFAHMROOAVEN-WAYWQWQTSA-N. The full InChI is InChI=1S/C13H18N2O/c1-4-5-6-11-10(2)7-8-15-9-12(11)13(16)14-3/h5-7,9H,4,8H2,1-3H3,(H,14,16)/b6-5-.
What are the key properties of 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide?
5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide has a molecular weight of 218.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-N,4-dimethyl-2H-azepine-6-carboxamide is sourced from PubChem (CID 170237531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).