About 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one
5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 170237991) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 170237991 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCNc1nc2c(c(C)cn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C11H16N4O/c1-4-5-12-11-13-9-8(10(16)14-11)7(2)6-15(9)3/h6H,4-5H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | JMZKNWBRSRVONS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one (CID 170237991) is 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one is CCCNc1nc2c(c(C)cn2C)c(=O)[nH]1.
What is the InChIKey of 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is JMZKNWBRSRVONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-4-5-12-11-13-9-8(10(16)14-11)7(2)6-15(9)3/h6H,4-5H2,1-3H3,(H2,12,13,14,16).
What are the key properties of 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one?
5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 220.28 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2-(propylamino)-3H-pyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 170237991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).