C11H12N2O4 — CID 170238249
4-propan-2-yl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 170238249) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-propan-2-yl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 4-propan-2-yl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 170238249 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-propan-2-yl-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | CC(C)N1C(=O)C2C3C(=O)NC(=O)C3C2C1=O |
| InChI | InChI=1S/C11H12N2O4/c1-3(2)13-10(16)6-4-5(7(6)11(13)17)9(15)12-8(4)14/h3-7H,1-2H3,(H,12,14,15) |
| InChIKey | ZOMLKZDTDKRQFR-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|