C14H16N4O4 — CID 170238575
1-methyl-2,3-dioxo-4-piperidin-4-ylpyrido[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 170238575) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-methyl-2,3-dioxo-4-piperidin-4-ylpyrido[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 1-methyl-2,3-dioxo-4-piperidin-4-ylpyrido[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 170238575 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-methyl-2,3-dioxo-4-piperidin-4-ylpyrido[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | Cn1c(=O)c(=O)n(C2CCNCC2)c2ncc(C(=O)O)cc21 |
| InChI | InChI=1S/C14H16N4O4/c1-17-10-6-8(14(21)22)7-16-11(10)18(13(20)12(17)19)9-2-4-15-5-3-9/h6-7,9,15H,2-5H2,1H3,(H,21,22) |
| InChIKey | NUWANYMOHSHPHN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|